C13H13FN4O3S — CID 168714693
1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714693) has the molecular formula C13H13FN4O3S and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714693 |
| Molecular Formula | C13H13FN4O3S |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cn1nc(-c2cccnc2)cc1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H13FN4O3S/c1-17-12(6-11(16-17)9-3-2-4-15-7-9)18-8-10(5-13(18)19)22(14,20)21/h2-4,6-7,10H,5,8H2,1H3 |
| InChIKey | ODLGHNMDGXAKJM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |