C9H12FN3O4S — CID 168716142
1-[2-(2-hydroxyethyl)pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168716142) has the molecular formula C9H12FN3O4S and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethyl)pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[2-(2-hydroxyethyl)pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168716142 |
| Molecular Formula | C9H12FN3O4S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-[2-(2-hydroxyethyl)pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1ccnn1CCO |
| InChI | InChI=1S/C9H12FN3O4S/c10-18(16,17)7-5-9(15)12(6-7)8-1-2-11-13(8)3-4-14/h1-2,7,14H,3-6H2 |
| InChIKey | WSEQYQOTWPGBCE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |