C15H16N4O2S — CID 168705858
S-[1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705858) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is S-[1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705858 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | S-[1-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(-c3cccnc3)nn2C)C1 |
| InChI | InChI=1S/C15H16N4O2S/c1-10(20)22-12-6-15(21)19(9-12)14-7-13(17-18(14)2)11-4-3-5-16-8-11/h3-5,7-8,12H,6,9H2,1-2H3 |
| InChIKey | RMVFEIOADSRFFQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|