C16H15N3O3S — CID 168705887
S-[5-oxo-1-(6-oxo-1-phenylpyridazin-4-yl)pyrrolidin-3-yl] ethanethioate (PubChem CID 168705887) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is S-[5-oxo-1-(6-oxo-1-phenylpyridazin-4-yl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-(6-oxo-1-phenylpyridazin-4-yl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705887 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | S-[5-oxo-1-(6-oxo-1-phenylpyridazin-4-yl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cnn(-c3ccccc3)c(=O)c2)C1 |
| InChI | InChI=1S/C16H15N3O3S/c1-11(20)23-14-8-15(21)18(10-14)13-7-16(22)19(17-9-13)12-5-3-2-4-6-12/h2-7,9,14H,8,10H2,1H3 |
| InChIKey | IBVCMNLQRKLVFO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|