C10H9FIN5O3S — CID 168677457
[1-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677457) has the molecular formula C10H9FIN5O3S and a molecular weight of 425.18 g/mol. Its IUPAC name is [1-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677457 |
| Molecular Formula | C10H9FIN5O3S |
| Molecular Weight | 425.18 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | [1-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ncnc2n[nH]c(I)c12 |
| InChI | InChI=1S/C10H9FIN5O3S/c11-21(19,20)3-5-1-6(18)17(2-5)10-7-8(12)15-16-9(7)13-4-14-10/h4-5H,1-3H2,(H,13,14,15,16) |
| InChIKey | OQTBLJSLGVYACT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|