C10H11N3O3S — CID 168708485
methyl 2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carboxylate (PubChem CID 168708485) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is methyl 2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carboxylate.
| Compound Name | methyl 2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 168708485 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | methyl 2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC(S)CC2=O)nc1 |
| InChI | InChI=1S/C10H11N3O3S/c1-16-9(15)6-3-11-10(12-4-6)13-5-7(17)2-8(13)14/h3-4,7,17H,2,5H2,1H3 |
| InChIKey | GXGBBKHTSUDSLO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|