C11H12N4O4 — CID 168696464
methyl 2-(4-carbamoyl-2-oxopyrrolidin-1-yl)pyrimidine-5-carboxylate (PubChem CID 168696464) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is methyl 2-(4-carbamoyl-2-oxopyrrolidin-1-yl)pyrimidine-5-carboxylate.
| Compound Name | methyl 2-(4-carbamoyl-2-oxopyrrolidin-1-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 168696464 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl 2-(4-carbamoyl-2-oxopyrrolidin-1-yl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC(C(N)=O)CC2=O)nc1 |
| InChI | InChI=1S/C11H12N4O4/c1-19-10(18)7-3-13-11(14-4-7)15-5-6(9(12)17)2-8(15)16/h3-4,6H,2,5H2,1H3,(H2,12,17) |
| InChIKey | RKGQJVPTYSHFIR-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |