C13H15N3O4 — CID 168696431
methyl 2-amino-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)benzoate (PubChem CID 168696431) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 2-amino-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | methyl 2-amino-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168696431 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | methyl 2-amino-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2CC(C(N)=O)CC2=O)c1N |
| InChI | InChI=1S/C13H15N3O4/c1-20-13(19)8-3-2-4-9(11(8)14)16-6-7(12(15)18)5-10(16)17/h2-4,7H,5-6,14H2,1H3,(H2,15,18) |
| InChIKey | VNECDRLVQJOXDJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|