C14H13N3O4 — CID 168696400
methyl 4-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-cyanobenzoate (PubChem CID 168696400) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is methyl 4-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-cyanobenzoate.
| Compound Name | methyl 4-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-cyanobenzoate |
|---|---|
| PubChem CID | 168696400 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 4-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-cyanobenzoate |
| SMILES | COC(=O)c1ccc(N2CC(C(N)=O)CC2=O)c(C#N)c1 |
| InChI | InChI=1S/C14H13N3O4/c1-21-14(20)8-2-3-11(9(4-8)6-15)17-7-10(13(16)19)5-12(17)18/h2-4,10H,5,7H2,1H3,(H2,16,19) |
| InChIKey | BMLAPZXHOFSBSS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |