C13H16N4O4 — CID 168696363
methyl 5-(4-carbamoyl-2-oxopyrrolidin-1-yl)-6-(methylamino)pyridine-3-carboxylate (PubChem CID 168696363) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is methyl 5-(4-carbamoyl-2-oxopyrrolidin-1-yl)-6-(methylamino)pyridine-3-carboxylate.
| Compound Name | methyl 5-(4-carbamoyl-2-oxopyrrolidin-1-yl)-6-(methylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 168696363 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 5-(4-carbamoyl-2-oxopyrrolidin-1-yl)-6-(methylamino)pyridine-3-carboxylate |
| SMILES | CNc1ncc(C(=O)OC)cc1N1CC(C(N)=O)CC1=O |
| InChI | InChI=1S/C13H16N4O4/c1-15-12-9(3-7(5-16-12)13(20)21-2)17-6-8(11(14)19)4-10(17)18/h3,5,8H,4,6H2,1-2H3,(H2,14,19)(H,15,16) |
| InChIKey | DJPKNYUEPHWWPJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |