C9H9N5OS — CID 168710214
4-amino-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile (PubChem CID 168710214) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 4-amino-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168710214 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 4-amino-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(N2CC(S)CC2=O)nc1N |
| InChI | InChI=1S/C9H9N5OS/c10-2-5-3-12-9(13-8(5)11)14-4-6(16)1-7(14)15/h3,6,16H,1,4H2,(H2,11,12,13) |
| InChIKey | XIZGDIADPTXKCO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|