C10H10N4OS2 — CID 168708705
2-methylsulfanyl-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile (PubChem CID 168708705) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168708705 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-methylsulfanyl-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyrimidine-5-carbonitrile |
| SMILES | CSc1ncc(C#N)c(N2CC(S)CC2=O)n1 |
| InChI | InChI=1S/C10H10N4OS2/c1-17-10-12-4-6(3-11)9(13-10)14-5-7(16)2-8(14)15/h4,7,16H,2,5H2,1H3 |
| InChIKey | QUDILMUQNLAQHE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|