C8H10N4OS — CID 168710625
1-(4-aminopyrimidin-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168710625) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 1-(4-aminopyrimidin-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(4-aminopyrimidin-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168710625 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(4-aminopyrimidin-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | Nc1ccnc(N2CC(S)CC2=O)n1 |
| InChI | InChI=1S/C8H10N4OS/c9-6-1-2-10-8(11-6)12-4-5(14)3-7(12)13/h1-2,5,14H,3-4H2,(H2,9,10,11) |
| InChIKey | HOIHRQATYPHVHV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|