C14H15ClN2O4S — CID 168666722
methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-chloropyridine-4-carboxylate (PubChem CID 168666722) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-chloropyridine-4-carboxylate.
| Compound Name | methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 168666722 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-chloropyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(Cl)c1N1CC(CSC(C)=O)CC1=O |
| InChI | InChI=1S/C14H15ClN2O4S/c1-8(18)22-7-9-5-11(19)17(6-9)12-10(14(20)21-2)3-4-16-13(12)15/h3-4,9H,5-7H2,1-2H3 |
| InChIKey | DILIQSKEMAWOAG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|