C10H12N4O2S — CID 168669065
S-[[5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168669065) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is S-[[5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168669065 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | S-[[5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ncncn2)C1 |
| InChI | InChI=1S/C10H12N4O2S/c1-7(15)17-4-8-2-9(16)14(3-8)10-12-5-11-6-13-10/h5-6,8H,2-4H2,1H3 |
| InChIKey | XDHWJMFZVLYALC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|