C15H18N2O3S — CID 168666389
S-[[1-(3-acetamidophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666389) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is S-[[1-(3-acetamidophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(3-acetamidophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666389 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | S-[[1-(3-acetamidophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)Nc1cccc(N2CC(CSC(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-10(18)16-13-4-3-5-14(7-13)17-8-12(6-15(17)20)9-21-11(2)19/h3-5,7,12H,6,8-9H2,1-2H3,(H,16,18) |
| InChIKey | SIDWPYIMDGUEFF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|