C14H14F3NO2S2 — CID 168668864
S-[[5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668864) has the molecular formula C14H14F3NO2S2 and a molecular weight of 349.40 g/mol. Its IUPAC name is S-[[5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668864 |
| Molecular Formula | C14H14F3NO2S2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | S-[[5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2cccc(SC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H14F3NO2S2/c1-9(19)21-8-10-5-13(20)18(7-10)11-3-2-4-12(6-11)22-14(15,16)17/h2-4,6,10H,5,7-8H2,1H3 |
| InChIKey | WZPAHMYFVLVLHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|