C11H9ClF3NOS — CID 168689839
4-chloro-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-2-one (PubChem CID 168689839) has the molecular formula C11H9ClF3NOS and a molecular weight of 295.71 g/mol. Its IUPAC name is 4-chloro-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-chloro-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168689839 |
| Molecular Formula | C11H9ClF3NOS |
| Molecular Weight | 295.71 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 4-chloro-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C11H9ClF3NOS/c12-7-4-10(17)16(6-7)8-2-1-3-9(5-8)18-11(13,14)15/h1-3,5,7H,4,6H2 |
| InChIKey | USOBIYNPFKVFSL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|