C13H12F3NO3S — CID 168695303
methyl 5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-3-carboxylate (PubChem CID 168695303) has the molecular formula C13H12F3NO3S and a molecular weight of 319.30 g/mol. Its IUPAC name is methyl 5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168695303 |
| Molecular Formula | C13H12F3NO3S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl 5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cccc(SC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H12F3NO3S/c1-20-12(19)8-5-11(18)17(7-8)9-3-2-4-10(6-9)21-13(14,15)16/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | BHDWCRQKDDHBCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |