C17H22N2O5 — CID 168692932
methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 168692932) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168692932 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cccc(NC(=O)OC(C)(C)C)c2)C1 |
| InChI | InChI=1S/C17H22N2O5/c1-17(2,3)24-16(22)18-12-6-5-7-13(9-12)19-10-11(8-14(19)20)15(21)23-4/h5-7,9,11H,8,10H2,1-4H3,(H,18,22) |
| InChIKey | YOBSODQWXOPTRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |