C20H19NO3S — CID 168668806
S-[[1-(3-benzoylphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668806) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is S-[[1-(3-benzoylphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(3-benzoylphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668806 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | S-[[1-(3-benzoylphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2cccc(C(=O)c3ccccc3)c2)C1 |
| InChI | InChI=1S/C20H19NO3S/c1-14(22)25-13-15-10-19(23)21(12-15)18-9-5-8-17(11-18)20(24)16-6-3-2-4-7-16/h2-9,11,15H,10,12-13H2,1H3 |
| InChIKey | KACJEVMKQKJRRT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|