C11H12N2O4S — CID 168671735
1-(2-hydroxy-4-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671735) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-(2-hydroxy-4-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-hydroxy-4-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671735 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(2-hydroxy-4-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C11H12N2O4S/c14-10-4-8(13(16)17)1-2-9(10)12-5-7(6-18)3-11(12)15/h1-2,4,7,14,18H,3,5-6H2 |
| InChIKey | LBMHTHULXNTKOF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|