C11H11FN2O4 — CID 168663711
1-(2-fluoro-4-nitrophenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168663711) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168663711 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CO)CN1c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H11FN2O4/c12-9-4-8(14(17)18)1-2-10(9)13-5-7(6-15)3-11(13)16/h1-2,4,7,15H,3,5-6H2 |
| InChIKey | PIYHZYLJZMUAOM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|