C13H15FN2O5S — CID 168675534
methyl 3-amino-4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate (PubChem CID 168675534) has the molecular formula C13H15FN2O5S and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl 3-amino-4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-amino-4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 168675534 |
| Molecular Formula | C13H15FN2O5S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl 3-amino-4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CC(CS(=O)(=O)F)CC2=O)c(N)c1 |
| InChI | InChI=1S/C13H15FN2O5S/c1-21-13(18)9-2-3-11(10(15)5-9)16-6-8(4-12(16)17)7-22(14,19)20/h2-3,5,8H,4,6-7,15H2,1H3 |
| InChIKey | QDFGPKAVEVQFSF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|