C13H15FN2O5S — CID 168675866
3-amino-5-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylbenzoic acid (PubChem CID 168675866) has the molecular formula C13H15FN2O5S and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-amino-5-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylbenzoic acid.
| Compound Name | 3-amino-5-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 168675866 |
| Molecular Formula | C13H15FN2O5S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-amino-5-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylbenzoic acid |
| SMILES | Cc1c(N)cc(C(=O)O)cc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H15FN2O5S/c1-7-10(15)3-9(13(18)19)4-11(7)16-5-8(2-12(16)17)6-22(14,20)21/h3-4,8H,2,5-6,15H2,1H3,(H,18,19) |
| InChIKey | FDPFRMWVZIFRRV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|