C15H19ClN2O4S — CID 168711191
1-[4-(diethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711191) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is 1-[4-(diethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-[4-(diethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711191 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[4-(diethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | CCN(CC)C(=O)c1ccc(N2CC(S(=O)(=O)Cl)CC2=O)cc1 |
| InChI | InChI=1S/C15H19ClN2O4S/c1-3-17(4-2)15(20)11-5-7-12(8-6-11)18-10-13(9-14(18)19)23(16,21)22/h5-8,13H,3-4,9-10H2,1-2H3 |
| InChIKey | NMPDFVYIIBOZSM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |