C12H15N3O4S — CID 168716959
N-[3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)phenyl]acetamide (PubChem CID 168716959) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | N-[3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 168716959 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N2CC(S(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C12H15N3O4S/c1-8(16)14-9-3-2-4-10(5-9)15-7-11(6-12(15)17)20(13,18)19/h2-5,11H,6-7H2,1H3,(H,14,16)(H2,13,18,19) |
| InChIKey | TWQXACWRQLXNRG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |