C12H15BrN2O4S — CID 168681236
[1-(3-bromo-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681236) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is [1-(3-bromo-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(3-bromo-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681236 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | [1-(3-bromo-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | COc1cc(Br)cc(N2CC(CS(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C12H15BrN2O4S/c1-19-11-4-9(13)3-10(5-11)15-6-8(2-12(15)16)7-20(14,17)18/h3-5,8H,2,6-7H2,1H3,(H2,14,17,18) |
| InChIKey | PZNYYSRJJANQSQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |