C12H11BrClF3N2O2 — CID 168660478
4-(aminomethyl)-1-[2-bromo-6-chloro-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 168660478) has the molecular formula C12H11BrClF3N2O2 and a molecular weight of 387.58 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[2-bromo-6-chloro-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-[2-bromo-6-chloro-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660478 |
| Molecular Formula | C12H11BrClF3N2O2 |
| Molecular Weight | 387.58 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 4-(aminomethyl)-1-[2-bromo-6-chloro-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2c(Cl)cc(OC(F)(F)F)cc2Br)C1 |
| InChI | InChI=1S/C12H11BrClF3N2O2/c13-8-2-7(21-12(15,16)17)3-9(14)11(8)19-5-6(4-18)1-10(19)20/h2-3,6H,1,4-5,18H2 |
| InChIKey | VUJOZFQKEZWQRZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |