C11H13NO4 — CID 168664025
1-(3,5-dihydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168664025) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(3,5-dihydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168664025 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CO)CN1c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H13NO4/c13-6-7-1-11(16)12(5-7)8-2-9(14)4-10(15)3-8/h2-4,7,13-15H,1,5-6H2 |
| InChIKey | YMQALOATZGJIQF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |