C10H11ClN2OS — CID 168709041
1-(6-chloro-5-methyl-3-pyridinyl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709041) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 1-(6-chloro-5-methyl-3-pyridinyl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(6-chloro-5-methyl-3-pyridinyl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709041 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-(6-chloro-5-methyl-3-pyridinyl)-4-sulfanylpyrrolidin-2-one |
| SMILES | Cc1cc(N2CC(S)CC2=O)cnc1Cl |
| InChI | InChI=1S/C10H11ClN2OS/c1-6-2-7(4-12-10(6)11)13-5-8(15)3-9(13)14/h2,4,8,15H,3,5H2,1H3 |
| InChIKey | SQARLVWFOWLYIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|