C11H14N2O2 — CID 168702673
1-(5,6-dimethyl-3-pyridinyl)-4-hydroxypyrrolidin-2-one (PubChem CID 168702673) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(5,6-dimethyl-3-pyridinyl)-4-hydroxypyrrolidin-2-one.
| Compound Name | 1-(5,6-dimethyl-3-pyridinyl)-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 168702673 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(5,6-dimethyl-3-pyridinyl)-4-hydroxypyrrolidin-2-one |
| SMILES | Cc1cc(N2CC(O)CC2=O)cnc1C |
| InChI | InChI=1S/C11H14N2O2/c1-7-3-9(5-12-8(7)2)13-6-10(14)4-11(13)15/h3,5,10,14H,4,6H2,1-2H3 |
| InChIKey | AEJZASLFTQSMGR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |