C12H14BrN3O2 — CID 168696736
1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168696736) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168696736 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cc(N)c(N2CC(C(N)=O)CC2=O)cc1Br |
| InChI | InChI=1S/C12H14BrN3O2/c1-6-2-9(14)10(4-8(6)13)16-5-7(12(15)18)3-11(16)17/h2,4,7H,3,5,14H2,1H3,(H2,15,18) |
| InChIKey | ACKLBYRHTIQMPV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|