C12H13BrN2O3 — CID 168691005
1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168691005) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168691005 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-(2-amino-5-bromo-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(N)c(N2CC(C(=O)O)CC2=O)cc1Br |
| InChI | InChI=1S/C12H13BrN2O3/c1-6-2-9(14)10(4-8(6)13)15-5-7(12(17)18)3-11(15)16/h2,4,7H,3,5,14H2,1H3,(H,17,18) |
| InChIKey | SPDITQJQWXGOEO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|