C13H15BrN2O2 — CID 168696281
1-(2-bromo-4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168696281) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 1-(2-bromo-4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-bromo-4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168696281 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 1-(2-bromo-4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2CC(C(N)=O)CC2=O)c(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-2-8-3-4-11(10(14)5-8)16-7-9(13(15)18)6-12(16)17/h3-5,9H,2,6-7H2,1H3,(H2,15,18) |
| InChIKey | WMZOMJGRJQOJOB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |