C14H16FNO2 — CID 168684186
4-ethenyl-1-(2-ethoxy-4-fluorophenyl)pyrrolidin-2-one (PubChem CID 168684186) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 4-ethenyl-1-(2-ethoxy-4-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(2-ethoxy-4-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168684186 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-ethenyl-1-(2-ethoxy-4-fluorophenyl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2ccc(F)cc2OCC)C1 |
| InChI | InChI=1S/C14H16FNO2/c1-3-10-7-14(17)16(9-10)12-6-5-11(15)8-13(12)18-4-2/h3,5-6,8,10H,1,4,7,9H2,2H3 |
| InChIKey | IVZGLFRSKXQMQW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|