C14H14FNO2 — CID 168500548
1-(2-ethoxy-4-fluorophenyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168500548) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 1-(2-ethoxy-4-fluorophenyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2-ethoxy-4-fluorophenyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168500548 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(2-ethoxy-4-fluorophenyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc(F)cc2OCC)C1 |
| InChI | InChI=1S/C14H14FNO2/c1-3-10-7-14(17)16(9-10)12-6-5-11(15)8-13(12)18-4-2/h1,5-6,8,10H,4,7,9H2,2H3 |
| InChIKey | HFEJKNWMIALKRA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|