C14H14N2O4 — CID 168500551
1-(4-ethoxy-2-nitrophenyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168500551) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(4-ethoxy-2-nitrophenyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(4-ethoxy-2-nitrophenyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168500551 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(4-ethoxy-2-nitrophenyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc(OCC)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H14N2O4/c1-3-10-7-14(17)15(9-10)12-6-5-11(20-4-2)8-13(12)16(18)19/h1,5-6,8,10H,4,7,9H2,2H3 |
| InChIKey | MFUHPRPBPMAXEV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|