C14H14N2O3 — CID 168501097
1-(2,3-dimethyl-6-nitrophenyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168501097) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-(2,3-dimethyl-6-nitrophenyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2,3-dimethyl-6-nitrophenyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168501097 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(2,3-dimethyl-6-nitrophenyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2c([N+](=O)[O-])ccc(C)c2C)C1 |
| InChI | InChI=1S/C14H14N2O3/c1-4-11-7-13(17)15(8-11)14-10(3)9(2)5-6-12(14)16(18)19/h1,5-6,11H,7-8H2,2-3H3 |
| InChIKey | PZQHQFLWIDDBJT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|