C14H15NO3S — CID 168501187
4-ethynyl-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one (PubChem CID 168501187) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is 4-ethynyl-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168501187 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-ethynyl-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cc(S(C)(=O)=O)ccc2C)C1 |
| InChI | InChI=1S/C14H15NO3S/c1-4-11-7-14(16)15(9-11)13-8-12(19(3,17)18)6-5-10(13)2/h1,5-6,8,11H,7,9H2,2-3H3 |
| InChIKey | HPAWDMKPNVMTQD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|