C13H18N2O3S — CID 168659855
4-(aminomethyl)-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one (PubChem CID 168659855) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168659855 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-(aminomethyl)-1-(2-methyl-5-methylsulfonylphenyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1N1CC(CN)CC1=O |
| InChI | InChI=1S/C13H18N2O3S/c1-9-3-4-11(19(2,17)18)6-12(9)15-8-10(7-14)5-13(15)16/h3-4,6,10H,5,7-8,14H2,1-2H3 |
| InChIKey | LUGKBYFWTLHKIF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |