C11H12N2O5 — CID 168702293
4-hydroxy-1-(4-methoxy-2-nitrophenyl)pyrrolidin-2-one (PubChem CID 168702293) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 4-hydroxy-1-(4-methoxy-2-nitrophenyl)pyrrolidin-2-one.
| Compound Name | 4-hydroxy-1-(4-methoxy-2-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168702293 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-hydroxy-1-(4-methoxy-2-nitrophenyl)pyrrolidin-2-one |
| SMILES | COc1ccc(N2CC(O)CC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2O5/c1-18-8-2-3-9(10(5-8)13(16)17)12-6-7(14)4-11(12)15/h2-3,5,7,14H,4,6H2,1H3 |
| InChIKey | CERBVINBJBDQJT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|