C20H21N3O7 — CID 9351512
(3R)-1-(2,4-dimethoxyphenyl)-N-(4-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 9351512) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is (3R)-1-(2,4-dimethoxyphenyl)-N-(4-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2,4-dimethoxyphenyl)-N-(4-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9351512 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (3R)-1-(2,4-dimethoxyphenyl)-N-(4-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@H](C(=O)Nc3ccc(OC)cc3[N+](=O)[O-])CC2=O)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O7/c1-28-13-4-6-15(17(9-13)23(26)27)21-20(25)12-8-19(24)22(11-12)16-7-5-14(29-2)10-18(16)30-3/h4-7,9-10,12H,8,11H2,1-3H3,(H,21,25)/t12-/m1/s1 |
| InChIKey | NYJYEADWMWEAQA-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|