C20H24ClN3O4 — CID 120568987
N-(5-amino-2-methylphenyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120568987) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120568987 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(N2CC(C(=O)Nc3cc(N)ccc3C)CC2=O)c(OC)c1.Cl |
| InChI | InChI=1S/C20H23N3O4.ClH/c1-12-4-5-14(21)9-16(12)22-20(25)13-8-19(24)23(11-13)17-7-6-15(26-2)10-18(17)27-3;/h4-7,9-10,13H,8,11,21H2,1-3H3,(H,22,25);1H |
| InChIKey | DIHKKAIXWKRZDF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|