C14H14FNO3 — CID 168684357
methyl 2-(4-ethenyl-2-oxopyrrolidin-1-yl)-4-fluorobenzoate (PubChem CID 168684357) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is methyl 2-(4-ethenyl-2-oxopyrrolidin-1-yl)-4-fluorobenzoate.
| Compound Name | methyl 2-(4-ethenyl-2-oxopyrrolidin-1-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 168684357 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl 2-(4-ethenyl-2-oxopyrrolidin-1-yl)-4-fluorobenzoate |
| SMILES | C=CC1CC(=O)N(c2cc(F)ccc2C(=O)OC)C1 |
| InChI | InChI=1S/C14H14FNO3/c1-3-9-6-13(17)16(8-9)12-7-10(15)4-5-11(12)14(18)19-2/h3-5,7,9H,1,6,8H2,2H3 |
| InChIKey | OUBIRCONRWUIKB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|