C14H13F2NO3 — CID 168684318
methyl 3-(4-ethenyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoate (PubChem CID 168684318) has the molecular formula C14H13F2NO3 and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl 3-(4-ethenyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoate.
| Compound Name | methyl 3-(4-ethenyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 168684318 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 3-(4-ethenyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoate |
| SMILES | C=CC1CC(=O)N(c2ccc(F)c(C(=O)OC)c2F)C1 |
| InChI | InChI=1S/C14H13F2NO3/c1-3-8-6-11(18)17(7-8)10-5-4-9(15)12(13(10)16)14(19)20-2/h3-5,8H,1,6-7H2,2H3 |
| InChIKey | GTWUTBSVPXWGNS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|