C14H15BrClNO2 — CID 168684182
1-(3-bromo-5-chloro-2-ethoxyphenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168684182) has the molecular formula C14H15BrClNO2 and a molecular weight of 344.64 g/mol. Its IUPAC name is 1-(3-bromo-5-chloro-2-ethoxyphenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(3-bromo-5-chloro-2-ethoxyphenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168684182 |
| Molecular Formula | C14H15BrClNO2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 1-(3-bromo-5-chloro-2-ethoxyphenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(Cl)cc(Br)c2OCC)C1 |
| InChI | InChI=1S/C14H15BrClNO2/c1-3-9-5-13(18)17(8-9)12-7-10(16)6-11(15)14(12)19-4-2/h3,6-7,9H,1,4-5,8H2,2H3 |
| InChIKey | SBPKEODFXQJHPB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|