C12H11BrFNO2 — CID 168686294
1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168686294) has the molecular formula C12H11BrFNO2 and a molecular weight of 300.13 g/mol. Its IUPAC name is 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168686294 |
| Molecular Formula | C12H11BrFNO2 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(Br)cc(F)c2O)C1 |
| InChI | InChI=1S/C12H11BrFNO2/c1-2-7-3-11(16)15(6-7)10-5-8(13)4-9(14)12(10)17/h2,4-5,7,17H,1,3,6H2 |
| InChIKey | WPRIXTFYAXXVIU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|