C11H11BrFNO3 — CID 168663944
1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168663944) has the molecular formula C11H11BrFNO3 and a molecular weight of 304.12 g/mol. Its IUPAC name is 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168663944 |
| Molecular Formula | C11H11BrFNO3 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CO)CN1c1cc(Br)cc(F)c1O |
| InChI | InChI=1S/C11H11BrFNO3/c12-7-2-8(13)11(17)9(3-7)14-4-6(5-15)1-10(14)16/h2-3,6,15,17H,1,4-5H2 |
| InChIKey | JLYKURVSRYVUBA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |