C11H10Br2N2O — CID 168686161
1-(5,6-dibromo-2-pyridinyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168686161) has the molecular formula C11H10Br2N2O and a molecular weight of 346.02 g/mol. Its IUPAC name is 1-(5,6-dibromo-2-pyridinyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(5,6-dibromo-2-pyridinyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168686161 |
| Molecular Formula | C11H10Br2N2O |
| Molecular Weight | 346.02 g/mol |
| Exact Mass | 343.92 |
| IUPAC Name | 1-(5,6-dibromo-2-pyridinyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2ccc(Br)c(Br)n2)C1 |
| InChI | InChI=1S/C11H10Br2N2O/c1-2-7-5-10(16)15(6-7)9-4-3-8(12)11(13)14-9/h2-4,7H,1,5-6H2 |
| InChIKey | MPJQTMNFUFHZPX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|